CAS 109877-66-9 appears in our catalog under these names: Methyl 2-fluoro-4,5-dimethoxybenzoate, ≥95%, ≥95%, Methyl 2-fluoro-4,5-dimethoxybenzoate, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g.
Methyl 2-fluoro-4,5-dimethoxybenzoate (CAS 109877-66-9) is a chemical compound with the molecular formula C10H11FO4 and a molecular weight of 214.19 g/mol. IUPAC name: methyl 2-fluoro-4,5-dimethoxybenzoate. InChIKey: GWSAQROFRIDQID-UHFFFAOYSA-N.
| Molecular formula | C10H11FO4 |
|---|---|
| Molecular weight | 214.19 g/mol |
| IUPAC name | methyl 2-fluoro-4,5-dimethoxybenzoate |
| InChIKey | GWSAQROFRIDQID-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C(=O)OC)F)OC |
Computed by PubChem (NCBI)