CAS 109882-30-6 appears in our catalog under these names: Bendamustine Impurity 4 (Dihydroxy Impurity), Bendamustine Impurity 8 Monomer(Bendamustine USP RC A Monomer), Dihydroxy bendamustine sodium salt, Bendamustine Impurity 8（Bendamustine USP RC A）. Offered by: Chemat Brand, Hubei YoungXin, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
4-[5-[bis(2-hydroxyethyl)amino]-1-methylbenzimidazol-2-yl]butanoic acid (CAS 109882-30-6) is a chemical compound with the molecular formula C16H23N3O4 and a molecular weight of 321.37 g/mol. IUPAC name: 4-[5-[bis(2-hydroxyethyl)amino]-1-methylbenzimidazol-2-yl]butanoic acid. InChIKey: XQMDIDKYVZPCNV-UHFFFAOYSA-N.
| Molecular formula | C16H23N3O4 |
|---|---|
| Molecular weight | 321.37 g/mol |
| IUPAC name | 4-[5-[bis(2-hydroxyethyl)amino]-1-methylbenzimidazol-2-yl]butanoic acid |
| InChIKey | XQMDIDKYVZPCNV-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)N(CCO)CCO)N=C1CCCC(=O)O |
Computed by PubChem (NCBI)