Products 1794737-33-9
CAS 1794737-33-9 is the registry number for Dihydroxy Bendamustine-d3. Offered by: TRC. Available pack sizes: 50mg.
4-[5-[bis(2-hydroxyethyl)amino]-1-(trideuteriomethyl)benzimidazol-2-yl]butanoic acid (CAS 1794737-33-9) is a chemical compound with the molecular formula C16H23N3O4 and a molecular weight of 324.39 g/mol. IUPAC name: 4-[5-[bis(2-hydroxyethyl)amino]-1-(trideuteriomethyl)benzimidazol-2-yl]butanoic acid. InChIKey: XQMDIDKYVZPCNV-FIBGUPNXSA-N.
| Molecular formula | C16H23N3O4 |
|---|---|
| Molecular weight | 324.39 g/mol |
| IUPAC name | 4-[5-[bis(2-hydroxyethyl)amino]-1-(trideuteriomethyl)benzimidazol-2-yl]butanoic acid |
| InChIKey | XQMDIDKYVZPCNV-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1C2=C(C=C(C=C2)N(CCO)CCO)N=C1CCCC(=O)O |
Computed by PubChem (NCBI)