Products 1099184-83-4

CAS 1099184-83-4 is the registry number for 3-(Sulfamoylmethyl)benzoic Acid. Offered by: TRC, Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

3-(sulfamoylmethyl)benzoic acid (CAS 1099184-83-4) is a chemical compound with the molecular formula C8H9NO4S and a molecular weight of 215.23 g/mol. IUPAC name: 3-(sulfamoylmethyl)benzoic acid. InChIKey: LNLWKMAZBPYIJG-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9NO4S
Molecular weight215.23 g/mol
IUPAC name3-(sulfamoylmethyl)benzoic acid
InChIKeyLNLWKMAZBPYIJG-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)C(=O)O)CS(=O)(=O)N

Computed by PubChem (NCBI)