CAS 1099184-83-4 is the registry number for 3-(Sulfamoylmethyl)benzoic Acid. Offered by: TRC, Biosynth. Available pack sizes: 2,5g, 250mg.
3-(sulfamoylmethyl)benzoic acid (CAS 1099184-83-4) is a chemical compound with the molecular formula C8H9NO4S and a molecular weight of 215.23 g/mol. IUPAC name: 3-(sulfamoylmethyl)benzoic acid. InChIKey: LNLWKMAZBPYIJG-UHFFFAOYSA-N.
| Molecular formula | C8H9NO4S |
|---|---|
| Molecular weight | 215.23 g/mol |
| IUPAC name | 3-(sulfamoylmethyl)benzoic acid |
| InChIKey | LNLWKMAZBPYIJG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)CS(=O)(=O)N |
Computed by PubChem (NCBI)