CAS 1099632-53-7 appears in our catalog under these names: 2-Propylbenzene-1-sulfonyl chloride, 95%, 2-Propylbenzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
2-propylbenzenesulfonyl chloride (CAS 1099632-53-7) is a chemical compound with the molecular formula C9H11ClO2S and a molecular weight of 218.70 g/mol. IUPAC name: 2-propylbenzenesulfonyl chloride. InChIKey: NAURBQKSUZFYQT-UHFFFAOYSA-N.
| Molecular formula | C9H11ClO2S |
|---|---|
| Molecular weight | 218.70 g/mol |
| IUPAC name | 2-propylbenzenesulfonyl chloride |
| InChIKey | NAURBQKSUZFYQT-UHFFFAOYSA-N |
| SMILES | CCCC1=CC=CC=C1S(=O)(=O)Cl |
Computed by PubChem (NCBI)