Products 1101120-88-0
CAS 1101120-88-0 is the registry number for 1-(5-Aminopyrazolo[1,5-a]pyridin-3-yl)ethanone, 95%. Offered by: Chemat. Available pack sizes: 1g.
1-(5-aminopyrazolo[1,5-a]pyridin-3-yl)ethanone (CAS 1101120-88-0) is a chemical compound with the molecular formula C9H9N3O and a molecular weight of 175.19 g/mol. IUPAC name: 1-(5-aminopyrazolo[1,5-a]pyridin-3-yl)ethanone. InChIKey: DKNWPKSUGSZHIR-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O |
|---|---|
| Molecular weight | 175.19 g/mol |
| IUPAC name | 1-(5-aminopyrazolo[1,5-a]pyridin-3-yl)ethanone |
| InChIKey | DKNWPKSUGSZHIR-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C2C=C(C=CN2N=C1)N |
Computed by PubChem (NCBI)