CAS 1101781-50-3 appears in our catalog under these names: 2-Amino-2-(2-(trifluoromethoxy)phenyl)acetic acid, 95%, 2–Amino–2–(2–(trifluoromethoxy)phenyl)acetic acid. Offered by: AmBeed, GLPBio. Available pack sizes: 5g, 100mg, 1g, 250mg.
2-amino-2-[2-(trifluoromethoxy)phenyl]acetic acid (CAS 1101781-50-3) is a chemical compound with the molecular formula C9H8F3NO3 and a molecular weight of 235.16 g/mol. IUPAC name: 2-amino-2-[2-(trifluoromethoxy)phenyl]acetic acid. InChIKey: OCEJACWMGCIPJQ-UHFFFAOYSA-N.
| Molecular formula | C9H8F3NO3 |
|---|---|
| Molecular weight | 235.16 g/mol |
| IUPAC name | 2-amino-2-[2-(trifluoromethoxy)phenyl]acetic acid |
| InChIKey | OCEJACWMGCIPJQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(C(=O)O)N)OC(F)(F)F |
Computed by PubChem (NCBI)