CAS 110231-26-0 appears in our catalog under these names: 3-(2-Chloroethyl)-6,7-dimethoxyquinazoline-2,4(1h,3h)-dione, 95%, 3-(2-Chloroethyl)-6,7-dimethoxyquinazoline-2,4(1H,3H)-dione, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
3-(2-chloroethyl)-6,7-dimethoxy-1H-quinazoline-2,4-dione (CAS 110231-26-0) is a chemical compound with the molecular formula C12H13ClN2O4 and a molecular weight of 284.69 g/mol. IUPAC name: 3-(2-chloroethyl)-6,7-dimethoxy-1H-quinazoline-2,4-dione. InChIKey: WTZNVCLWQHGBDC-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2O4 |
|---|---|
| Molecular weight | 284.69 g/mol |
| IUPAC name | 3-(2-chloroethyl)-6,7-dimethoxy-1H-quinazoline-2,4-dione |
| InChIKey | WTZNVCLWQHGBDC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=O)N(C(=O)N2)CCCl)OC |
Computed by PubChem (NCBI)