Products 958457-83-5
CAS 958457-83-5 appears in our catalog under these names: Avatrombopag Impurity 33, Avatrombopag Impurity 31, 6-(4-Carboxy-1-piperidinyl)-5-chloro-3-pyridinecarboxylic acid, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg.
6-(4-carboxypiperidin-1-yl)-5-chloropyridine-3-carboxylic acid (CAS 958457-83-5) is a chemical compound with the molecular formula C12H13ClN2O4 and a molecular weight of 284.69 g/mol. IUPAC name: 6-(4-carboxypiperidin-1-yl)-5-chloropyridine-3-carboxylic acid. InChIKey: GLQRQGIFEOBSFP-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2O4 |
|---|---|
| Molecular weight | 284.69 g/mol |
| IUPAC name | 6-(4-carboxypiperidin-1-yl)-5-chloropyridine-3-carboxylic acid |
| InChIKey | GLQRQGIFEOBSFP-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C(=O)O)C2=C(C=C(C=N2)C(=O)O)Cl |
Computed by PubChem (NCBI)