CAS 1227827-90-8 is the registry number for 5-(6-Chloro-2-methoxy-pyridin-3-yl)-5-isopropyl-oxazolidine-2,4-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
5-(6-chloro-2-methoxy-3-pyridinyl)-5-propan-2-yl-1,3-oxazolidine-2,4-dione (CAS 1227827-90-8) is a chemical compound with the molecular formula C12H13ClN2O4 and a molecular weight of 284.69 g/mol. IUPAC name: 5-(6-chloro-2-methoxy-3-pyridinyl)-5-propan-2-yl-1,3-oxazolidine-2,4-dione. InChIKey: NVNXWVGTCNEWCV-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2O4 |
|---|---|
| Molecular weight | 284.69 g/mol |
| IUPAC name | 5-(6-chloro-2-methoxy-3-pyridinyl)-5-propan-2-yl-1,3-oxazolidine-2,4-dione |
| InChIKey | NVNXWVGTCNEWCV-UHFFFAOYSA-N |
| SMILES | CC(C)C1(C(=O)NC(=O)O1)C2=C(N=C(C=C2)Cl)OC |
Computed by PubChem (NCBI)