Products 1207062-38-1
CAS 1207062-38-1 is the registry number for 2-Chloro-2-(4'-methoxycarbonylphenylhydrazono)acetic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Methyl 4-[(2Z)-2-(1-chloro-2-ethoxy-2-oxoethylidene)hydrazinyl]benzoate (CAS 1207062-38-1) is a chemical compound with the molecular formula C12H13ClN2O4 and a molecular weight of 284.69 g/mol. IUPAC name: methyl 4-[(2Z)-2-(1-chloro-2-ethoxy-2-oxoethylidene)hydrazinyl]benzoate. InChIKey: KQZOHWDFXLGWPD-GDNBJRDFSA-N.
| Molecular formula | C12H13ClN2O4 |
|---|---|
| Molecular weight | 284.69 g/mol |
| IUPAC name | methyl 4-[(2Z)-2-(1-chloro-2-ethoxy-2-oxoethylidene)hydrazinyl]benzoate |
| InChIKey | KQZOHWDFXLGWPD-GDNBJRDFSA-N |
| SMILES | CCOC(=O)/C(=N/NC1=CC=C(C=C1)C(=O)OC)/Cl |
Computed by PubChem (NCBI)