CAS 2140305-89-9 is the registry number for tert-Butyl N-(6-chloro-2,4-diformylpyridin-3-yl)carbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
Tert-butyl N-(6-chloro-2,4-diformyl-3-pyridinyl)carbamate (CAS 2140305-89-9) is a chemical compound with the molecular formula C12H13ClN2O4 and a molecular weight of 284.69 g/mol. IUPAC name: tert-butyl N-(6-chloro-2,4-diformyl-3-pyridinyl)carbamate. InChIKey: JLDDJHMKYVHCTF-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2O4 |
|---|---|
| Molecular weight | 284.69 g/mol |
| IUPAC name | tert-butyl N-(6-chloro-2,4-diformyl-3-pyridinyl)carbamate |
| InChIKey | JLDDJHMKYVHCTF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(N=C(C=C1C=O)Cl)C=O |
Computed by PubChem (NCBI)