CAS 63555-50-0 appears in our catalog under these names: Methyl 3–(chlorosulfonyl)benzoate, Methyl 3-(chlorosulfonyl)benzoate 96%, Methyl 3-(chlorosulfonyl)benzoate, 95%. Offered by: GLPBio, Ambeed, Fluorochem. Available pack sizes: 1g, 25g, 5g, 10g, 20g, 100g.
Methyl 3-chlorosulfonylbenzoate (CAS 63555-50-0) is a chemical compound with the molecular formula C8H7ClO4S and a molecular weight of 234.66 g/mol. IUPAC name: methyl 3-chlorosulfonylbenzoate. InChIKey: SQIBNKUEUWGZBH-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO4S |
|---|---|
| Molecular weight | 234.66 g/mol |
| IUPAC name | methyl 3-chlorosulfonylbenzoate |
| InChIKey | SQIBNKUEUWGZBH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)