CAS 110503-62-3 appears in our catalog under these names: (Z)-4-(4-Chloro-1-(4-(2-(dimethylamino)ethoxy)phenyl)-2-phenylbut-1-en-1-yl)phenol, 98%, Toremifene Impurity 7, 4-Hydroxy Toremifene, 4-Hydroxy Toremifene, >95% (HPLC), 4-Hydroxytoremifene. Offered by: Chemat Brand, TRC, Biosynth, MedChemExpress. Available pack sizes: on request, 100mg, 10mg, 50mg, 25mg, 10 mg, 5 mg.
4-[(Z)-4-chloro-1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenol (CAS 110503-62-3) is a chemical compound with the molecular formula C26H28ClNO2 and a molecular weight of 422.0 g/mol. IUPAC name: 4-[(Z)-4-chloro-1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenol. InChIKey: OIUCUUXSMIJSEB-QPLCGJKRSA-N.
| Molecular formula | C26H28ClNO2 |
|---|---|
| Molecular weight | 422.0 g/mol |
| IUPAC name | 4-[(Z)-4-chloro-1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenol |
| InChIKey | OIUCUUXSMIJSEB-QPLCGJKRSA-N |
| SMILES | CN(C)CCOC1=CC=C(C=C1)/C(=C(/CCCl)\C2=CC=CC=C2)/C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)