Products 163130-29-8
CAS 163130-29-8 appears in our catalog under these names: Toremifene Impurity 1, Toremifene N-Oxide, Toremifene-N-oxide, Toremifene N-Oxide Fumarate. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 10mg, 5mg, 25mg.
2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]-N,N-dimethylethanamine oxide (CAS 163130-29-8) is a chemical compound with the molecular formula C26H28ClNO2 and a molecular weight of 422.0 g/mol. IUPAC name: 2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]-N,N-dimethylethanamine oxide. InChIKey: KDHIASPFJAGSRF-QPLCGJKRSA-N.
| Molecular formula | C26H28ClNO2 |
|---|---|
| Molecular weight | 422.0 g/mol |
| IUPAC name | 2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]-N,N-dimethylethanamine oxide |
| InChIKey | KDHIASPFJAGSRF-QPLCGJKRSA-N |
| SMILES | C[N+](C)(CCOC1=CC=C(C=C1)/C(=C(/CCCl)\C2=CC=CC=C2)/C3=CC=CC=C3)[O-] |
Computed by PubChem (NCBI)