CAS 352233-94-4 is the registry number for 4’-Hydroxy Toremifene (~8% E isomer). Offered by: TRC. Available pack sizes: 10mg, 1mg.
4-[(Z)-4-chloro-1-[4-[2-(dimethylamino)ethoxy]phenyl]-1-phenylbut-1-en-2-yl]phenol (CAS 352233-94-4) is a chemical compound with the molecular formula C26H28ClNO2 and a molecular weight of 422.0 g/mol. IUPAC name: 4-[(Z)-4-chloro-1-[4-[2-(dimethylamino)ethoxy]phenyl]-1-phenylbut-1-en-2-yl]phenol. InChIKey: OOHZFZLDKFJSRJ-QPLCGJKRSA-N.
| Molecular formula | C26H28ClNO2 |
|---|---|
| Molecular weight | 422.0 g/mol |
| IUPAC name | 4-[(Z)-4-chloro-1-[4-[2-(dimethylamino)ethoxy]phenyl]-1-phenylbut-1-en-2-yl]phenol |
| InChIKey | OOHZFZLDKFJSRJ-QPLCGJKRSA-N |
| SMILES | CN(C)CCOC1=CC=C(C=C1)/C(=C(/CCCl)\C2=CC=C(C=C2)O)/C3=CC=CC=C3 |
Computed by PubChem (NCBI)