Products 79838-56-5
CAS 79838-56-5 is the registry number for E-Clomiphene N-oxide. Offered by: Chemat Brand. Available pack sizes: on request.
2-[4-[(E)-2-chloro-1,2-diphenylethenyl]phenoxy]-N,N-diethylethanamine oxide (CAS 79838-56-5) is a chemical compound with the molecular formula C26H28ClNO2 and a molecular weight of 422.0 g/mol. IUPAC name: 2-[4-[(E)-2-chloro-1,2-diphenylethenyl]phenoxy]-N,N-diethylethanamine oxide. InChIKey: PGHWCZITRQNIPM-OCEACIFDSA-N.
| Molecular formula | C26H28ClNO2 |
|---|---|
| Molecular weight | 422.0 g/mol |
| IUPAC name | 2-[4-[(E)-2-chloro-1,2-diphenylethenyl]phenoxy]-N,N-diethylethanamine oxide |
| InChIKey | PGHWCZITRQNIPM-OCEACIFDSA-N |
| SMILES | CC[N+](CC)(CCOC1=CC=C(C=C1)/C(=C(\C2=CC=CC=C2)/Cl)/C3=CC=CC=C3)[O-] |
Computed by PubChem (NCBI)