CAS 97642-74-5 appears in our catalog under these names: Clomifene Impurity 12, Clomiphene N-Oxide, >95% (HPLC), Clomiphene N–Oxide, Clomiphene N-oxide, Clomiphene N-Oxide, ≥95%, ≥95%. Offered by: Hubei YoungXin, TRC, GLPBio, Biosynth, Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
2-[4-[(Z)-2-chloro-1,2-diphenylethenyl]phenoxy]-N,N-diethylethanamine oxide (CAS 97642-74-5) is a chemical compound with the molecular formula C26H28ClNO2 and a molecular weight of 422.0 g/mol. IUPAC name: 2-[4-[(Z)-2-chloro-1,2-diphenylethenyl]phenoxy]-N,N-diethylethanamine oxide. InChIKey: PGHWCZITRQNIPM-QPLCGJKRSA-N.
| Molecular formula | C26H28ClNO2 |
|---|---|
| Molecular weight | 422.0 g/mol |
| IUPAC name | 2-[4-[(Z)-2-chloro-1,2-diphenylethenyl]phenoxy]-N,N-diethylethanamine oxide |
| InChIKey | PGHWCZITRQNIPM-QPLCGJKRSA-N |
| SMILES | CC[N+](CC)(CCOC1=CC=C(C=C1)/C(=C(/C2=CC=CC=C2)\Cl)/C3=CC=CC=C3)[O-] |
Computed by PubChem (NCBI)