CAS 1105067-92-2 appears in our catalog under these names: Atorvastatin Impurity 136, (3S,5S)-6-Cyano-3,5-dihydroxyhexanoic Acid 1,1-Dimethylethyl Ester. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
Tert-butyl (3S,5S)-6-cyano-3,5-dihydroxyhexanoate (CAS 1105067-92-2) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: tert-butyl (3S,5S)-6-cyano-3,5-dihydroxyhexanoate. InChIKey: NQTYMGFSEOSJKM-IUCAKERBSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | tert-butyl (3S,5S)-6-cyano-3,5-dihydroxyhexanoate |
| InChIKey | NQTYMGFSEOSJKM-IUCAKERBSA-N |
| SMILES | CC(C)(C)OC(=O)C[C@H](C[C@H](CC#N)O)O |
Computed by PubChem (NCBI)