CAS 125971-93-9 appears in our catalog under these names: Atorvastatin Impurity 43, (3R,5R)-tert-Butyl 6-cyano-3,5-dihydroxyhexanoate, 95+%, Atorvastatin Impurity 111, (3R,5R)-6-Cyano-3,5-dihydroxy-hexanoic Acid tert-Butyl Ester, >95% (GC), tert–butyl (3R，5R)–6–cyano–3，5–dihydroxy–hexanoate. Offered by: Chemat Brand, Hubei YoungXin, TRC, GLPBio, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg, 0,05g.
Tert-butyl (3R,5R)-6-cyano-3,5-dihydroxyhexanoate (CAS 125971-93-9) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: tert-butyl (3R,5R)-6-cyano-3,5-dihydroxyhexanoate. InChIKey: NQTYMGFSEOSJKM-RKDXNWHRSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | tert-butyl (3R,5R)-6-cyano-3,5-dihydroxyhexanoate |
| InChIKey | NQTYMGFSEOSJKM-RKDXNWHRSA-N |
| SMILES | CC(C)(C)OC(=O)C[C@@H](C[C@@H](CC#N)O)O |
Computed by PubChem (NCBI)