CAS 1105189-52-3 is the registry number for 5-amino-1-(4-methylphenyl)-1,5-dihydro-4H-pyrazolo(3,4-d)pyrimidin-4-one, 95%. Offered by: AmBeed. Available pack sizes: 10g, 5g.
5-amino-1-(4-methylphenyl)pyrazolo[5,4-d]pyrimidin-4-one (CAS 1105189-52-3) is a chemical compound with the molecular formula C12H11N5O and a molecular weight of 241.25 g/mol. IUPAC name: 5-amino-1-(4-methylphenyl)pyrazolo[5,4-d]pyrimidin-4-one. InChIKey: ISBVKEUKRZYSQV-UHFFFAOYSA-N.
| Molecular formula | C12H11N5O |
|---|---|
| Molecular weight | 241.25 g/mol |
| IUPAC name | 5-amino-1-(4-methylphenyl)pyrazolo[5,4-d]pyrimidin-4-one |
| InChIKey | ISBVKEUKRZYSQV-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2C3=C(C=N2)C(=O)N(C=N3)N |
Computed by PubChem (NCBI)