CAS 925006-60-6 is the registry number for 1-(4-Methoxyphenyl)-1h-pyrazolo[3,4-d]pyrimidin-4-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
1-(4-methoxyphenyl)pyrazolo[3,4-d]pyrimidin-4-amine (CAS 925006-60-6) is a chemical compound with the molecular formula C12H11N5O and a molecular weight of 241.25 g/mol. IUPAC name: 1-(4-methoxyphenyl)pyrazolo[3,4-d]pyrimidin-4-amine. InChIKey: TWRVJKDDEYQGIB-UHFFFAOYSA-N.
| Molecular formula | C12H11N5O |
|---|---|
| Molecular weight | 241.25 g/mol |
| IUPAC name | 1-(4-methoxyphenyl)pyrazolo[3,4-d]pyrimidin-4-amine |
| InChIKey | TWRVJKDDEYQGIB-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)N2C3=NC=NC(=C3C=N2)N |
Computed by PubChem (NCBI)