CAS 882252-36-0 is the registry number for 6-(Aminomethyl)-1-phenyl-1H-pyrazolo(3,4-d)pyrimidin-4(5H)-one. Offered by: TRC. Available pack sizes: 250mg.
6-(aminomethyl)-1-phenyl-5H-pyrazolo[5,4-d]pyrimidin-4-one (CAS 882252-36-0) is a chemical compound with the molecular formula C12H11N5O and a molecular weight of 241.25 g/mol. IUPAC name: 6-(aminomethyl)-1-phenyl-5H-pyrazolo[5,4-d]pyrimidin-4-one. InChIKey: ZDDAXFBAQWOPCZ-UHFFFAOYSA-N.
| Molecular formula | C12H11N5O |
|---|---|
| Molecular weight | 241.25 g/mol |
| IUPAC name | 6-(aminomethyl)-1-phenyl-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| InChIKey | ZDDAXFBAQWOPCZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C3=C(C=N2)C(=O)NC(=N3)CN |
Computed by PubChem (NCBI)