CAS 924633-24-9 is the registry number for (2,6-Di(1H-pyrazol-1-yl)pyridin-4-yl)methanol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[2,6-di(pyrazol-1-yl)-4-pyridinyl]methanol (CAS 924633-24-9) is a chemical compound with the molecular formula C12H11N5O and a molecular weight of 241.25 g/mol. IUPAC name: [2,6-di(pyrazol-1-yl)-4-pyridinyl]methanol. InChIKey: DQGSSQVYHFKNOR-UHFFFAOYSA-N.
| Molecular formula | C12H11N5O |
|---|---|
| Molecular weight | 241.25 g/mol |
| IUPAC name | [2,6-di(pyrazol-1-yl)-4-pyridinyl]methanol |
| InChIKey | DQGSSQVYHFKNOR-UHFFFAOYSA-N |
| SMILES | C1=CN(N=C1)C2=CC(=CC(=N2)N3C=CC=N3)CO |
Computed by PubChem (NCBI)