CAS 1616613-79-6 appears in our catalog under these names: 3-Ethyl-7-phenyl-3H,4H,7H-pyrazolo(3,4-d)(1,2,3)triazin-4-one, 95%, 3-Ethyl-7-phenyl-3H,4H,7H-pyrazolo(3,4-d)(1,2,3)triazin-4-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
3-ethyl-7-phenylpyrazolo[5,4-d]triazin-4-one (CAS 1616613-79-6) is a chemical compound with the molecular formula C12H11N5O and a molecular weight of 241.25 g/mol. IUPAC name: 3-ethyl-7-phenylpyrazolo[5,4-d]triazin-4-one. InChIKey: KLLAVSWVXOLWTJ-UHFFFAOYSA-N.
| Molecular formula | C12H11N5O |
|---|---|
| Molecular weight | 241.25 g/mol |
| IUPAC name | 3-ethyl-7-phenylpyrazolo[5,4-d]triazin-4-one |
| InChIKey | KLLAVSWVXOLWTJ-UHFFFAOYSA-N |
| SMILES | CCN1C(=O)C2=C(N=N1)N(N=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)