CAS 1105193-79-0 appears in our catalog under these names: 5-(5-Chlorothiophen-2-yl)-1,3,4-oxadiazol-2-amine, 95%, 5-(5-Chlorothiophen-2-yl)-1,3,4-oxadiazol-2-amine, 96%, 5-(5-Chloro-2-thienyl)-1,3,4-oxadiazol-2-amine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
5-(5-chlorothiophen-2-yl)-1,3,4-oxadiazol-2-amine (CAS 1105193-79-0) is a chemical compound with the molecular formula C6H4ClN3OS and a molecular weight of 201.63 g/mol. IUPAC name: 5-(5-chlorothiophen-2-yl)-1,3,4-oxadiazol-2-amine. InChIKey: IISIIFVRALMMOS-UHFFFAOYSA-N.
| Molecular formula | C6H4ClN3OS |
|---|---|
| Molecular weight | 201.63 g/mol |
| IUPAC name | 5-(5-chlorothiophen-2-yl)-1,3,4-oxadiazol-2-amine |
| InChIKey | IISIIFVRALMMOS-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)Cl)C2=NN=C(O2)N |
Computed by PubChem (NCBI)