CAS 951123-18-5 is the registry number for 5-(Chloromethyl)-3-(thiazol-2-yl)-1,2,4-oxadiazole, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g, 25g.
5-(chloromethyl)-3-(1,3-thiazol-2-yl)-1,2,4-oxadiazole (CAS 951123-18-5) is a chemical compound with the molecular formula C6H4ClN3OS and a molecular weight of 201.63 g/mol. IUPAC name: 5-(chloromethyl)-3-(1,3-thiazol-2-yl)-1,2,4-oxadiazole. InChIKey: UYAILRZXWIGDFN-UHFFFAOYSA-N.
| Molecular formula | C6H4ClN3OS |
|---|---|
| Molecular weight | 201.63 g/mol |
| IUPAC name | 5-(chloromethyl)-3-(1,3-thiazol-2-yl)-1,2,4-oxadiazole |
| InChIKey | UYAILRZXWIGDFN-UHFFFAOYSA-N |
| SMILES | C1=CSC(=N1)C2=NOC(=N2)CCl |
Computed by PubChem (NCBI)