Products 87572-02-9
CAS 87572-02-9 appears in our catalog under these names: 7-(Chloromethyl)-5h-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one, 95%, 7-(Chloromethyl)-5H-(1,3,4)thiadiazolo(3,2-a)pyrimidin-5-one, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
7-(chloromethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one (CAS 87572-02-9) is a chemical compound with the molecular formula C6H4ClN3OS and a molecular weight of 201.63 g/mol. IUPAC name: 7-(chloromethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one. InChIKey: ZWFLCUVUUVPDLZ-UHFFFAOYSA-N.
| Molecular formula | C6H4ClN3OS |
|---|---|
| Molecular weight | 201.63 g/mol |
| IUPAC name | 7-(chloromethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
| InChIKey | ZWFLCUVUUVPDLZ-UHFFFAOYSA-N |
| SMILES | C1=C(N=C2N(C1=O)N=CS2)CCl |
Computed by PubChem (NCBI)