CAS 20015-70-7 appears in our catalog under these names: 4-Chloro-5H-pyrimido(4,5-b)(1,4)thiazin-6(7H)-one, 97%, 4-Chloro-5H,6H,7H-pyrimido(4,5-b)(1,4)thiazin-6-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-chloro-5H-pyrimido[4,5-b][1,4]thiazin-6-one (CAS 20015-70-7) is a chemical compound with the molecular formula C6H4ClN3OS and a molecular weight of 201.63 g/mol. IUPAC name: 4-chloro-5H-pyrimido[4,5-b][1,4]thiazin-6-one. InChIKey: MKDDAWZPKMATGS-UHFFFAOYSA-N.
| Molecular formula | C6H4ClN3OS |
|---|---|
| Molecular weight | 201.63 g/mol |
| IUPAC name | 4-chloro-5H-pyrimido[4,5-b][1,4]thiazin-6-one |
| InChIKey | MKDDAWZPKMATGS-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(S1)N=CN=C2Cl |
Computed by PubChem (NCBI)