CAS 1691673-42-3 appears in our catalog under these names: 2-Chloro-5H,6H,7H-pyrimido(4,5-b)(1,4)thiazin-6-one, 95%, 2-Chloro-5H,6H,7H-pyrimido(4,5-b)(1,4)thiazin-6-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-chloro-5H-pyrimido[4,5-b][1,4]thiazin-6-one (CAS 1691673-42-3) is a chemical compound with the molecular formula C6H4ClN3OS and a molecular weight of 201.63 g/mol. IUPAC name: 2-chloro-5H-pyrimido[4,5-b][1,4]thiazin-6-one. InChIKey: DALVYSNAVDNQEV-UHFFFAOYSA-N.
| Molecular formula | C6H4ClN3OS |
|---|---|
| Molecular weight | 201.63 g/mol |
| IUPAC name | 2-chloro-5H-pyrimido[4,5-b][1,4]thiazin-6-one |
| InChIKey | DALVYSNAVDNQEV-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=CN=C(N=C2S1)Cl |
Computed by PubChem (NCBI)