CAS 1105195-61-6 appears in our catalog under these names: 6-(2-Thienyl)-4(3H)-pyrimidinone, 6-(Thiophen-2-yl)pyrimidin-4-ol. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 1g.
4-thiophen-2-yl-1H-pyrimidin-6-one (CAS 1105195-61-6) is a chemical compound with the molecular formula C8H6N2OS and a molecular weight of 178.21 g/mol. IUPAC name: 4-thiophen-2-yl-1H-pyrimidin-6-one. InChIKey: BDPBCAUQPGNSHX-UHFFFAOYSA-N.
| Molecular formula | C8H6N2OS |
|---|---|
| Molecular weight | 178.21 g/mol |
| IUPAC name | 4-thiophen-2-yl-1H-pyrimidin-6-one |
| InChIKey | BDPBCAUQPGNSHX-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=CC(=O)NC=N2 |
Computed by PubChem (NCBI)