CAS 110622-46-3 appears in our catalog under these names: L–Tyrosine–13C, L-TYROSINE-1-13C, >=99 ATOM % 13C, >=98&, L-Tyrosine-13C, 98%, 98%, L-Tyrosine-13C, 98.6%. Offered by: GLPBio, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 1G, 1 mg, 10 mg, 5 mg.
(2S)-2-amino-3-(4-hydroxyphenyl)(113C)propanoic acid (CAS 110622-46-3) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 182.18 g/mol. IUPAC name: (2S)-2-amino-3-(4-hydroxyphenyl)(113C)propanoic acid. InChIKey: OUYCCCASQSFEME-DMSOPOIOSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 182.18 g/mol |
| IUPAC name | (2S)-2-amino-3-(4-hydroxyphenyl)(113C)propanoic acid |
| InChIKey | OUYCCCASQSFEME-DMSOPOIOSA-N |
| SMILES | C1=CC(=CC=C1C[C@@H]([13C](=O)O)N)O |
Computed by PubChem (NCBI)