Products 1202064-22-9
CAS 1202064-22-9 appears in our catalog under these names: D-4-Hydroxyphenylalanine-3,3-d2, 99 atom % D, min 98% Chemical Purity, D-Tyrosine-d2, >95% (HPLC), D-Tyrosine-d2. Offered by: CDN, TRC, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 100mg, 10mg, 25mg, 25 mg, 100 mg, 10 mg.
(2R)-2-amino-3,3-dideuterio-3-(4-hydroxyphenyl)propanoic acid (CAS 1202064-22-9) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 183.20 g/mol. IUPAC name: (2R)-2-amino-3,3-dideuterio-3-(4-hydroxyphenyl)propanoic acid. InChIKey: OUYCCCASQSFEME-JZAVKUPRSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 183.20 g/mol |
| IUPAC name | (2R)-2-amino-3,3-dideuterio-3-(4-hydroxyphenyl)propanoic acid |
| InChIKey | OUYCCCASQSFEME-JZAVKUPRSA-N |
| SMILES | [2H]C([2H])(C1=CC=C(C=C1)O)[C@H](C(=O)O)N |
Computed by PubChem (NCBI)