CAS 1426174-46-0 appears in our catalog under these names: D-4-Hydroxyphenyl-d4-alanine-2,3,3-d3, 98 atom % D, min 98% Chemical Purity, D-Tyrosine-d7, 97.27%. Offered by: CDN, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 10 mg, 1 mg, 5 mg.
(2R)-2-amino-2,3,3-trideuterio-3-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)propanoic acid (CAS 1426174-46-0) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 188.23 g/mol. IUPAC name: (2R)-2-amino-2,3,3-trideuterio-3-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)propanoic acid. InChIKey: OUYCCCASQSFEME-PENPODLISA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 188.23 g/mol |
| IUPAC name | (2R)-2-amino-2,3,3-trideuterio-3-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)propanoic acid |
| InChIKey | OUYCCCASQSFEME-PENPODLISA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C([2H])([2H])[C@]([2H])(C(=O)O)N)[2H])[2H])O)[2H] |
Computed by PubChem (NCBI)