Products 110661-61-5

CAS 110661-61-5 is the registry number for (4-Nitrophenyl)methanesulfonyl fluoride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

(4-nitrophenyl)methanesulfonyl fluoride (CAS 110661-61-5) is a chemical compound with the molecular formula C7H6FNO4S and a molecular weight of 219.19 g/mol. IUPAC name: (4-nitrophenyl)methanesulfonyl fluoride. InChIKey: VKSZNRBZGINFCE-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6FNO4S
Molecular weight219.19 g/mol
IUPAC name(4-nitrophenyl)methanesulfonyl fluoride
InChIKeyVKSZNRBZGINFCE-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1CS(=O)(=O)F)[N+](=O)[O-]

Computed by PubChem (NCBI)