CAS 112887-25-9 appears in our catalog under these names: 2-Fluoro-5-sulfamoylbenzoic acid, 95%, 2-Fluoro-5-sulfamoylbenzoic acid 95%, 2-Fluoro-5-sulfamoylbenzoic acid, ≥95%, ≥95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 100mg, 250mg, 50mg.
2-fluoro-5-sulfamoylbenzoic acid (CAS 112887-25-9) is a chemical compound with the molecular formula C7H6FNO4S and a molecular weight of 219.19 g/mol. IUPAC name: 2-fluoro-5-sulfamoylbenzoic acid. InChIKey: MNNOFRJMHLQDOE-UHFFFAOYSA-N.
| Molecular formula | C7H6FNO4S |
|---|---|
| Molecular weight | 219.19 g/mol |
| IUPAC name | 2-fluoro-5-sulfamoylbenzoic acid |
| InChIKey | MNNOFRJMHLQDOE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)N)C(=O)O)F |
Computed by PubChem (NCBI)