CAS 244606-37-9 appears in our catalog under these names: 3-Fluoro-4-sulfamoylbenzoic acid, 95%, 3-Fluoro-4-sulphamoylbenzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 5g.
3-fluoro-4-sulfamoylbenzoic acid (CAS 244606-37-9) is a chemical compound with the molecular formula C7H6FNO4S and a molecular weight of 219.19 g/mol. IUPAC name: 3-fluoro-4-sulfamoylbenzoic acid. InChIKey: VVFLFTAOLYCDDT-UHFFFAOYSA-N.
| Molecular formula | C7H6FNO4S |
|---|---|
| Molecular weight | 219.19 g/mol |
| IUPAC name | 3-fluoro-4-sulfamoylbenzoic acid |
| InChIKey | VVFLFTAOLYCDDT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)F)S(=O)(=O)N |
Computed by PubChem (NCBI)