Products 926220-60-2

CAS 926220-60-2 appears in our catalog under these names: 3-Fluoro-5-sulfamoylbenzoic acid, 95%, 3-Fluoro-5-sulfamoylbenzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.

Structural formula: {0} (CAS {1})

3-fluoro-5-sulfamoylbenzoic acid (CAS 926220-60-2) is a chemical compound with the molecular formula C7H6FNO4S and a molecular weight of 219.19 g/mol. IUPAC name: 3-fluoro-5-sulfamoylbenzoic acid. InChIKey: YISIWFAAPGFMHU-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6FNO4S
Molecular weight219.19 g/mol
IUPAC name3-fluoro-5-sulfamoylbenzoic acid
InChIKeyYISIWFAAPGFMHU-UHFFFAOYSA-N
SMILESC1=C(C=C(C=C1F)S(=O)(=O)N)C(=O)O

Computed by PubChem (NCBI)