CAS 1675732-94-1 appears in our catalog under these names: 2-Nitro-alpha-toluenesulfonyl fluoride, 95%, (2-Nitrophenyl)methanesulfonyl fluoride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
(2-nitrophenyl)methanesulfonyl fluoride (CAS 1675732-94-1) is a chemical compound with the molecular formula C7H6FNO4S and a molecular weight of 219.19 g/mol. IUPAC name: (2-nitrophenyl)methanesulfonyl fluoride. InChIKey: GVMXMZRIMPJDBZ-UHFFFAOYSA-N.
| Molecular formula | C7H6FNO4S |
|---|---|
| Molecular weight | 219.19 g/mol |
| IUPAC name | (2-nitrophenyl)methanesulfonyl fluoride |
| InChIKey | GVMXMZRIMPJDBZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CS(=O)(=O)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)