CAS 1107627-21-3 appears in our catalog under these names: (1-Methyl-1H-benzimidazol-5-yl)boronic acid, 95%, (1-Methyl-1H-benzo[d]imidazol-5-yl)boronic acid 98+%, (1-Methyl-1H-benzo[d]imidazol-5-yl)boronic acid, 98%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 250mg, 1g, 50mg, 100mg, 5g.
(1-methylbenzimidazol-5-yl)boronic acid (CAS 1107627-21-3) is a chemical compound with the molecular formula C8H9BN2O2 and a molecular weight of 175.98 g/mol. IUPAC name: (1-methylbenzimidazol-5-yl)boronic acid. InChIKey: ULAHHADVEXVVEN-UHFFFAOYSA-N.
| Molecular formula | C8H9BN2O2 |
|---|---|
| Molecular weight | 175.98 g/mol |
| IUPAC name | (1-methylbenzimidazol-5-yl)boronic acid |
| InChIKey | ULAHHADVEXVVEN-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)N(C=N2)C)(O)O |
Computed by PubChem (NCBI)