Products 1108666-05-2
CAS 1108666-05-2 appears in our catalog under these names: 2–Amino–5–(difluoromethoxy)benzoic acid, 2-Amino-5-(difluoromethoxy)benzoic acid, 97%. Offered by: GLPBio, Fluorochem, Ambeed, BLDpharm, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 50mg.
2-amino-5-(difluoromethoxy)benzoic acid (CAS 1108666-05-2) is a chemical compound with the molecular formula C8H7F2NO3 and a molecular weight of 203.14 g/mol. IUPAC name: 2-amino-5-(difluoromethoxy)benzoic acid. InChIKey: VKINKNMSRZCLAZ-UHFFFAOYSA-N.
| Molecular formula | C8H7F2NO3 |
|---|---|
| Molecular weight | 203.14 g/mol |
| IUPAC name | 2-amino-5-(difluoromethoxy)benzoic acid |
| InChIKey | VKINKNMSRZCLAZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)F)C(=O)O)N |
Computed by PubChem (NCBI)
Synonyms:
2-amino-5-(difluoromethoxy)benzoic acid