CAS 110912-15-7 appears in our catalog under these names: 3-Chloro-1h-indole-2-carbaldehyde, 95%, 3-Chloro-1H-indole-2-carbaldehyde. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 0,25g, 0,1g, 0,5g, 5g.
3-chloro-1H-indole-2-carbaldehyde (CAS 110912-15-7) is a chemical compound with the molecular formula C9H6ClNO and a molecular weight of 179.60 g/mol. IUPAC name: 3-chloro-1H-indole-2-carbaldehyde. InChIKey: IHPBJLYJOIUBDY-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO |
|---|---|
| Molecular weight | 179.60 g/mol |
| IUPAC name | 3-chloro-1H-indole-2-carbaldehyde |
| InChIKey | IHPBJLYJOIUBDY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(N2)C=O)Cl |
Computed by PubChem (NCBI)