Products 110920-17-7
CAS 110920-17-7 is the registry number for Succinimidyl 3-bromobenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(2,5-dioxopyrrolidin-1-yl) 3-bromobenzoate (CAS 110920-17-7) is a chemical compound with the molecular formula C11H8BrNO4 and a molecular weight of 298.09 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-bromobenzoate. InChIKey: IZMCZURUJSWYNH-UHFFFAOYSA-N.
| Molecular formula | C11H8BrNO4 |
|---|---|
| Molecular weight | 298.09 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-bromobenzoate |
| InChIKey | IZMCZURUJSWYNH-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)