Products 30007-57-9

CAS 30007-57-9 is the registry number for 2-Bromo-3-(1,3-dioxoisoindolin-2-yl)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-bromo-3-(1,3-dioxoisoindol-2-yl)propanoic acid (CAS 30007-57-9) is a chemical compound with the molecular formula C11H8BrNO4 and a molecular weight of 298.09 g/mol. IUPAC name: 2-bromo-3-(1,3-dioxoisoindol-2-yl)propanoic acid. InChIKey: KDBHFOHTCIFMNU-UHFFFAOYSA-N.

Identity
Molecular formulaC11H8BrNO4
Molecular weight298.09 g/mol
IUPAC name2-bromo-3-(1,3-dioxoisoindol-2-yl)propanoic acid
InChIKeyKDBHFOHTCIFMNU-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=O)N(C2=O)CC(C(=O)O)Br

Computed by PubChem (NCBI)