CAS 67835-26-1 is the registry number for 2-(5-Bromo-1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl)propanoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-(5-bromo-1,3-dioxoisoindol-2-yl)propanoic acid (CAS 67835-26-1) is a chemical compound with the molecular formula C11H8BrNO4 and a molecular weight of 298.09 g/mol. IUPAC name: 2-(5-bromo-1,3-dioxoisoindol-2-yl)propanoic acid. InChIKey: NDJFZBLAXGRLTE-UHFFFAOYSA-N.
| Molecular formula | C11H8BrNO4 |
|---|---|
| Molecular weight | 298.09 g/mol |
| IUPAC name | 2-(5-bromo-1,3-dioxoisoindol-2-yl)propanoic acid |
| InChIKey | NDJFZBLAXGRLTE-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)N1C(=O)C2=C(C1=O)C=C(C=C2)Br |
Computed by PubChem (NCBI)