Products 67835-26-1

CAS 67835-26-1 is the registry number for 2-(5-Bromo-1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl)propanoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

2-(5-bromo-1,3-dioxoisoindol-2-yl)propanoic acid (CAS 67835-26-1) is a chemical compound with the molecular formula C11H8BrNO4 and a molecular weight of 298.09 g/mol. IUPAC name: 2-(5-bromo-1,3-dioxoisoindol-2-yl)propanoic acid. InChIKey: NDJFZBLAXGRLTE-UHFFFAOYSA-N.

Identity
Molecular formulaC11H8BrNO4
Molecular weight298.09 g/mol
IUPAC name2-(5-bromo-1,3-dioxoisoindol-2-yl)propanoic acid
InChIKeyNDJFZBLAXGRLTE-UHFFFAOYSA-N
SMILESCC(C(=O)O)N1C(=O)C2=C(C1=O)C=C(C=C2)Br

Computed by PubChem (NCBI)