Products 2306055-00-3
CAS 2306055-00-3 is the registry number for 3-Bromo-7-(methylcarbamoyl)benzofuran-5-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-7-(methylcarbamoyl)-1-benzofuran-5-carboxylic acid (CAS 2306055-00-3) is a chemical compound with the molecular formula C11H8BrNO4 and a molecular weight of 298.09 g/mol. IUPAC name: 3-bromo-7-(methylcarbamoyl)-1-benzofuran-5-carboxylic acid. InChIKey: GOWMFHVYASLHIK-UHFFFAOYSA-N.
| Molecular formula | C11H8BrNO4 |
|---|---|
| Molecular weight | 298.09 g/mol |
| IUPAC name | 3-bromo-7-(methylcarbamoyl)-1-benzofuran-5-carboxylic acid |
| InChIKey | GOWMFHVYASLHIK-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=CC(=CC2=C1OC=C2Br)C(=O)O |
Computed by PubChem (NCBI)