Products 1188072-48-1

CAS 1188072-48-1 is the registry number for 5-(2-Bromo-4-methoxyphenyl)isoxazole-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

5-(2-bromo-4-methoxyphenyl)-1,2-oxazole-3-carboxylic acid (CAS 1188072-48-1) is a chemical compound with the molecular formula C11H8BrNO4 and a molecular weight of 298.09 g/mol. IUPAC name: 5-(2-bromo-4-methoxyphenyl)-1,2-oxazole-3-carboxylic acid. InChIKey: ZTDHTWYSIVYODT-UHFFFAOYSA-N.

Identity
Molecular formulaC11H8BrNO4
Molecular weight298.09 g/mol
IUPAC name5-(2-bromo-4-methoxyphenyl)-1,2-oxazole-3-carboxylic acid
InChIKeyZTDHTWYSIVYODT-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C=C1)C2=CC(=NO2)C(=O)O)Br

Computed by PubChem (NCBI)