Products 110925-86-5
CAS 110925-86-5 is the registry number for 3-Deoxy-3-fluoro-D-fructose. Offered by: Biosynth, MedChemExpress. Available pack sizes: 1g, Get quote.
(3S,4R,5R)-3-fluoro-1,4,5,6-tetrahydroxyhexan-2-one (CAS 110925-86-5) is a chemical compound with the molecular formula C6H11FO5 and a molecular weight of 182.15 g/mol. IUPAC name: (3S,4R,5R)-3-fluoro-1,4,5,6-tetrahydroxyhexan-2-one. InChIKey: HHVKOFZGBKAVEK-HSUXUTPPSA-N.
| Molecular formula | C6H11FO5 |
|---|---|
| Molecular weight | 182.15 g/mol |
| IUPAC name | (3S,4R,5R)-3-fluoro-1,4,5,6-tetrahydroxyhexan-2-one |
| InChIKey | HHVKOFZGBKAVEK-HSUXUTPPSA-N |
| SMILES | C([C@H]([C@H]([C@@H](C(=O)CO)F)O)O)O |
Computed by PubChem (NCBI)