CAS 110952-90-4 appears in our catalog under these names: 2’-Deoxy-2-methyladenosine, 2-Methyl-2’-deoxyadenosine. Offered by: Biosynth, MedChemExpress. Available pack sizes: 100mg, 50mg, 250mg, Get quote.
(2R,3S,5R)-5-(6-amino-2-methylpurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol (CAS 110952-90-4) is a chemical compound with the molecular formula C11H15N5O3 and a molecular weight of 265.27 g/mol. IUPAC name: (2R,3S,5R)-5-(6-amino-2-methylpurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol. InChIKey: KSUGGAKGOCLWPT-XLPZGREQSA-N.
| Molecular formula | C11H15N5O3 |
|---|---|
| Molecular weight | 265.27 g/mol |
| IUPAC name | (2R,3S,5R)-5-(6-amino-2-methylpurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol |
| InChIKey | KSUGGAKGOCLWPT-XLPZGREQSA-N |
| SMILES | CC1=NC(=C2C(=N1)N(C=N2)[C@H]3C[C@@H]([C@H](O3)CO)O)N |
Computed by PubChem (NCBI)