Products 85562-60-3
CAS 85562-60-3 is the registry number for 8-Methyl-2’-deoxyadenosine, 95.0%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 5 mg, 1 mg.
(2R,3S,5R)-5-(6-amino-8-methylpurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol (CAS 85562-60-3) is a chemical compound with the molecular formula C11H15N5O3 and a molecular weight of 265.27 g/mol. IUPAC name: (2R,3S,5R)-5-(6-amino-8-methylpurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol. InChIKey: IJRWMSFJUAOOAR-XLPZGREQSA-N.
| Molecular formula | C11H15N5O3 |
|---|---|
| Molecular weight | 265.27 g/mol |
| IUPAC name | (2R,3S,5R)-5-(6-amino-8-methylpurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol |
| InChIKey | IJRWMSFJUAOOAR-XLPZGREQSA-N |
| SMILES | CC1=NC2=C(N=CN=C2N1[C@H]3C[C@@H]([C@H](O3)CO)O)N |
Computed by PubChem (NCBI)